AB46183
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $6.00 | $4.00 | - + | |
10g | 95% | in stock | $7.00 | $5.00 | - + | |
25g | 95% | in stock | $16.00 | $12.00 | - + | |
100g | 98% | in stock | $62.00 | $43.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46183 |
Chemical Name: | Fmoc-Tyr(tBu)-OH |
CAS Number: | 71989-38-3 |
Molecular Formula: | C28H29NO5 |
Molecular Weight: | 459.5336 |
MDL Number: | MFCD00037129 |
SMILES: | O=C(N[C@H](C(=O)O)Cc1ccc(cc1)OC(C)(C)C)OCC1c2ccccc2c2c1cccc2 |
Complexity: | 673 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 9 |
XLogP3: | 5.6 |
European journal of medicinal chemistry 20090501