AC63999
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | in stock | $18.00 | $13.00 | - + | |
100mg | 95% | in stock | $42.00 | $30.00 | - + | |
250mg | 95% | in stock | $76.00 | $53.00 | - + | |
1g | 95% | in stock | $264.00 | $185.00 | - + | |
5g | 95% | in stock | $751.00 | $526.00 | - + | |
25g | 95% | in stock | $3,744.00 | $2,621.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC63999 |
Chemical Name: | Succinimidyl 6-(biotinamido)hexanoate |
CAS Number: | 72040-63-2 |
Molecular Formula: | C20H30N4O6S |
Molecular Weight: | 454.5404 |
MDL Number: | MFCD00065502 |
SMILES: | O=C(CCCC[C@@H]1SC[C@H]2[C@@H]1NC(=O)N2)NCCCCCC(=O)ON1C(=O)CCC1=O |
Complexity: | 702 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 13 |
XLogP3: | 0.1 |
Journal of chromatography. A 20051014
Bioconjugate chemistry 20020101