AB77137
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $44.00 | $31.00 | - + | |
1g | 95% | in stock | $89.00 | $62.00 | - + | |
5g | 95% | in stock | $289.00 | $203.00 | - + | |
10g | 95% | in stock | $448.00 | $314.00 | - + | |
25g | 95% | in stock | $629.00 | $441.00 | - + | |
100g | 95% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB77137 |
Chemical Name: | N-Boc-L-phenylalaninal |
CAS Number: | 72155-45-4 |
Molecular Formula: | C14H19NO3 |
Molecular Weight: | 249.3056 |
MDL Number: | MFCD01208077 |
SMILES: | O=C[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
Complexity: | 277 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 2.5 |
Boc-Phe-CHO, also known as Boc-protected phenylalanine aldehyde, is a versatile chemical compound widely used in organic synthesis. This compound serves as a valuable building block in the production of various pharmaceuticals, agrochemicals, and materials due to its unique reactivity and functional group compatibility.One of the key applications of Boc-Phe-CHO in chemical synthesis is its role as a key intermediate in the synthesis of peptide mimetics and peptidomimetic compounds. Peptide mimetics are compounds that mimic the structure and function of peptides but offer enhanced stability and bioavailability. By incorporating Boc-Phe-CHO into the synthesis of peptide mimetics, chemists can tailor the properties of these compounds for specific applications, such as drug development and biotechnological research.Additionally, Boc-Phe-CHO is often used in the preparation of inhibitors targeting enzymes involved in various biological pathways. Its aldehyde functional group allows for selective modification of target proteins, enabling the design of potent and specific enzyme inhibitors. This makes Boc-Phe-CHO a valuable tool in the field of medicinal chemistry for developing novel therapeutics for treating diseases such as cancer, infectious diseases, and metabolic disorders.Furthermore, Boc-Phe-CHO can also be employed in the synthesis of peptidyl aldehydes, which are important intermediates in the production of peptidyl drugs and protease inhibitors. The aldehyde group in Boc-Phe-CHO facilitates the formation of stable covalent bonds with target proteins, making it an essential component in the design of enzyme inhibitors and therapeutic peptides.In conclusion, Boc-Phe-CHO plays a crucial role in chemical synthesis, particularly in the development of peptide mimetics, enzyme inhibitors, and peptidyl drugs. Its versatility and reactivity make it a valuable tool for chemists and researchers seeking to design innovative compounds for a wide range of applications in the pharmaceutical and biotechnology industries.
Bioorganic & medicinal chemistry letters 20071201
Archiv der Pharmazie 20070601
Bioorganic & medicinal chemistry letters 20060801