AB69005
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $22.00 | $15.00 | - + | |
1g | 95% | in stock | $26.00 | $18.00 | - + | |
5g | 95% | in stock | $65.00 | $45.00 | - + | |
25g | 95% | in stock | $81.00 | $57.00 | - + | |
50g | 95% | in stock | $158.00 | $111.00 | - + | |
100g | 95% | in stock | $314.00 | $220.00 | - + | |
250g | 95% | in stock | $781.00 | $547.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB69005 |
Chemical Name: | 5-Bromoindole-2-carboxylic acid |
CAS Number: | 7254-19-5 |
Molecular Formula: | C9H6BrNO2 |
Molecular Weight: | 240.0534 |
MDL Number: | MFCD00022705 |
SMILES: | Brc1ccc2c(c1)cc([nH]2)C(=O)O |
NSC Number: | 73384 |
Complexity: | 222 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 3 |
Journal of medicinal chemistry 20040506