AB66184
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $16.00 | $11.00 | - + | |
5g | 98% | in stock | $36.00 | $25.00 | - + | |
25g | 98% | in stock | $105.00 | $74.00 | - + | |
100g | 98% | in stock | $305.00 | $214.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB66184 |
Chemical Name: | Bis(4-Methoxyphenyl)methanol |
CAS Number: | 728-87-0 |
Molecular Formula: | C15H16O3 |
Molecular Weight: | 244.2857 |
MDL Number: | MFCD00008410 |
SMILES: | COc1ccc(cc1)C(c1ccc(cc1)OC)O |
NSC Number: | 5256 |
Complexity: | 204 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.7 |
Physical chemistry chemical physics : PCCP 20080107
The journal of physical chemistry. A 20050811