AC51516
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $34.00 | $24.00 | - + | |
5g | 95% | in stock | $84.00 | $59.00 | - + | |
25g | 95% | in stock | $214.00 | $150.00 | - + | |
100g | 95% | in stock | $699.00 | $489.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC51516 |
Chemical Name: | 2-Chloro-4-(trifluoromethyl)-5-thiazolecarboxylic acid phenylmethyl ester |
CAS Number: | 72850-64-7 |
Molecular Formula: | C12H7ClF3NO2S |
Molecular Weight: | 321.7027 |
MDL Number: | MFCD00072459 |
SMILES: | Clc1nc(c(s1)C(=O)OCc1ccccc1)C(F)(F)F |
Complexity: | 350 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 7 |
Rotatable Bond Count: | 4 |
XLogP3: | 4.5 |
Journal of plant physiology 20120501