logo
Home  > Chemistry  > Organic Building Blocks  > Nitroes  > 2-Fluoro-5-nitrobenzoic acid

AB62180

7304-32-7 | 2-Fluoro-5-nitrobenzoic acid

Packsize Purity Availability Price Discounted Price    Quantity
10g 98% in stock $10.00 $7.00 -   +
25g 98% in stock $20.00 $14.00 -   +
100g 98% in stock $34.00 $24.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB62180
Chemical Name: 2-Fluoro-5-nitrobenzoic acid
CAS Number: 7304-32-7
Molecular Formula: C7H4FNO4
Molecular Weight: 185.1094
MDL Number: MFCD00134238
SMILES: [O-][N+](=O)c1ccc(c(c1)C(=O)O)F
NSC Number: 133450

 

Computed Properties
Complexity: 227  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 13  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 1  
XLogP3: 1.5  

 

 

Upstream Synthesis Route
  • 2-Fluoro-5-nitrobenzoic acid is a versatile compound that finds significant application in chemical synthesis as a key building block. With its distinct molecular structure, this compound serves as a crucial intermediate in the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals.One of the primary uses of 2-Fluoro-5-nitrobenzoic acid is in the synthesis of fluorinated organic compounds, which have increasingly gained attention due to their unique properties and diverse applications in different fields. By incorporating this compound into chemical reactions, chemists can introduce fluorine atoms into target molecules, thereby modulating their reactivity, stability, and biological activity.Furthermore, 2-Fluoro-5-nitrobenzoic acid serves as a valuable starting material for the construction of complex organic molecules through functional group transformations. Its compatibility with various synthetic methodologies allows for the introduction of diverse functional groups, enabling the synthesis of structurally intricate compounds with specific properties and functionalities.In summary, the strategic incorporation of 2-Fluoro-5-nitrobenzoic acid in chemical synthesis enables the efficient preparation of diverse fluorinated and functionalized compounds, thus contributing to the development of innovative materials, pharmaceuticals, and agrochemicals.
FEATURED PRODUCTS