AZ87008
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $111.00 | $78.00 | - + | |
250mg | 98% | in stock | $177.00 | $124.00 | - + | |
1g | 98% | in stock | $448.00 | $314.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AZ87008 |
Chemical Name: | 1H-Indole-4-carboxylic acid, 5-bromo-, methyl ester |
CAS Number: | 731810-04-1 |
Molecular Formula: | C10H8BrNO2 |
Molecular Weight: | 254.08 |
MDL Number: | MFCD27965096 |
SMILES: | COC(=O)c1c(Br)ccc2c1cc[nH]2 |
Methyl 5-bromo-1H-indole-4-carboxylate is a valuable compound widely used in chemical synthesis processes. This versatile substance serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials. Its unique chemical structure allows it to participate in a range of reactions, offering synthetic chemists the ability to introduce indole and ester functionalities simultaneously. By incorporating Methyl 5-bromo-1H-indole-4-carboxylate into their synthetic pathways, researchers can access a diverse array of complex molecules with applications across multiple industries.