AB45640
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 99% | in stock | $5.00 | $3.00 | - + | |
10g | 99% | in stock | $6.00 | $4.00 | - + | |
25g | 99% | in stock | $9.00 | $6.00 | - + | |
100g | 95% | in stock | $22.00 | $16.00 | - + | |
250g | 99% | in stock | $55.00 | $38.00 | - + | |
500g | 99% | in stock | $92.00 | $64.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45640 |
Chemical Name: | Bis(pinacolato)diboron |
CAS Number: | 73183-34-3 |
Molecular Formula: | C12H24B2O4 |
Molecular Weight: | 253.9386 |
MDL Number: | MFCD00799570 |
SMILES: | CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C |
Complexity: | 286 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
Journal of the American Chemical Society 20090708
Molecules (Basel, Switzerland) 20040227
Organic & biomolecular chemistry 20030621
Journal of the American Chemical Society 20020710