AB43191
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $11.00 | $8.00 | - + | |
5g | 96% | in stock | $11.00 | $8.00 | - + | |
25g | 96% | in stock | $33.00 | $24.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43191 |
Chemical Name: | 1,4-Di-tert-butyl-2,5-dimethoxybenzene |
CAS Number: | 7323-63-9 |
Molecular Formula: | C16H26O2 |
Molecular Weight: | 250.3764 |
MDL Number: | MFCD00026281 |
SMILES: | COc1cc(c(cc1C(C)(C)C)OC)C(C)(C)C |
NSC Number: | 124045 |
Complexity: | 231 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 5.2 |
1,4-Di-tert-butyl-2,5-dimethoxybenzene, also known as $name$, is a versatile compound widely used in chemical synthesis as a protecting group in organic reactions. This compound serves as a valuable building block in the creation of complex organic molecules by temporarily masking certain functional groups to facilitate specific reactions without unwanted side reactions. Its unique properties make it an essential tool in the development of pharmaceuticals, agrochemicals, and materials science. By selectively protecting reactive sites within a molecule, $name$ enables chemists to achieve precise control over the course of a synthesis, leading to more efficient and reliable processes. Its application in chemical synthesis underscores its significance in the advancement of modern chemistry.
European journal of medicinal chemistry 20110501
Bioorganic & medicinal chemistry letters 20101101