AH12518
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $8.00 | $5.00 | - + | |
5g | 95% | in stock | $13.00 | $9.00 | - + | |
10g | 95% | in stock | $23.00 | $16.00 | - + | |
25g | 95% | in stock | $55.00 | $38.00 | - + | |
50g | 95% | in stock | $103.00 | $72.00 | - + | |
100g | 95% | in stock | $199.00 | $139.00 | - + | |
250g | 95% | in stock | $494.00 | $346.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH12518 |
Chemical Name: | Boc-L-DAP-OH |
CAS Number: | 73259-81-1 |
Molecular Formula: | C8H16N2O4 |
Molecular Weight: | 204.2236 |
MDL Number: | MFCD00236843 |
SMILES: | NC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Complexity: | 222 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | -2.7 |
3-Amino-Boc-L-alanine is a key compound utilized in advanced chemical synthesis processes, particularly in the field of pharmaceutical and drug development. This versatile compound plays a crucial role as a building block in the creation of various complex molecules and organic compounds.One of the primary applications of 3-Amino-Boc-L-alanine in chemical synthesis is its use as a protected amino acid derivative. With its Boc (tert-butoxycarbonyl) protecting group, this compound serves as a valuable tool for introducing amino acid functionality into peptide synthesis. By selectively deprotecting the Boc group under specific conditions, researchers can manipulate the reactivity of the amino acid, allowing for precise control over the formation of peptide bonds.Furthermore, 3-Amino-Boc-L-alanine can also be utilized in the preparation of modified amino acids and peptide mimetics. Through strategic functional group manipulations and chemical transformations, this compound enables the creation of novel chemical entities with diverse pharmacological properties and biological activities. Its involvement in the development of peptide-based therapeutics underscores the importance of 3-Amino-Boc-L-alanine in advancing the frontiers of modern drug discovery and design.In conclusion, the strategic incorporation of 3-Amino-Boc-L-alanine in chemical synthesis not only facilitates the construction of complex molecular scaffolds but also opens up new possibilities for discovering potent pharmaceutical agents and bioactive compounds.