logo
Home  > 3-Cyano-4-chloro-7-methoxyquinoline

AH15149

73387-74-3 | 3-Cyano-4-chloro-7-methoxyquinoline

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $58.00 $41.00 -   +
250mg 97% in stock $92.00 $65.00 -   +
1g 97% in stock $322.00 $225.00 -   +
5g 97% in stock $1,441.00 $1,009.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AH15149
Chemical Name: 3-Cyano-4-chloro-7-methoxyquinoline
CAS Number: 73387-74-3
Molecular Formula: C11H7ClN2O
Molecular Weight: 218.6391
MDL Number: MFCD12068428
SMILES: COc1ccc2c(c1)ncc(c2Cl)C#N

 

Upstream Synthesis Route 
  • 4-Chloro-7-methoxyquinoline-3-carbonitrile is a versatile chemical compound commonly used in chemical synthesis processes. Its unique structure and properties make it a valuable building block for the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. In chemical synthesis, this compound serves as a key intermediate for the production of complex molecules, enabling the formation of new carbon-carbon and carbon-nitrogen bonds. This molecule can be selectively modified at different positions, allowing chemists to tailor its reactivity for specific reactions. Overall, 4-Chloro-7-methoxyquinoline-3-carbonitrile plays a crucial role in the development of innovative chemical compounds with diverse applications in research and industry.
FEATURED PRODUCTS