AB63812
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $10.00 | $7.00 | - + | |
5g | 98% | in stock | $12.00 | $8.00 | - + | |
10g | 98% | in stock | $18.00 | $13.00 | - + | |
25g | ≥98% | in stock | $42.00 | $29.00 | - + | |
100g | 98% | in stock | $101.00 | $71.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB63812 |
Chemical Name: | 3,5-Bis(trifluoromethyl)phenylboronic acid |
CAS Number: | 73852-19-4 |
Molecular Formula: | C8H5BF6O2 |
Molecular Weight: | 257.9255 |
MDL Number: | MFCD00051850 |
SMILES: | OB(c1cc(cc(c1)C(F)(F)F)C(F)(F)F)O |
Complexity: | 242 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
Chemical communications (Cambridge, England) 20080821
Journal of medicinal chemistry 20070823
Organic letters 20060330