AB68999
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | tech | in stock | $15.00 | $10.00 | - + | |
5g | tech | in stock | $18.00 | $12.00 | - + | |
25g | 95% | in stock | $42.00 | $30.00 | - + | |
100g | 95% | in stock | $90.00 | $63.00 | - + | |
500g | 95% | in stock | $299.00 | $209.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB68999 |
Chemical Name: | 5-Bromoacetyl salicylamide |
CAS Number: | 73866-23-6 |
Molecular Formula: | C9H8BrNO3 |
Molecular Weight: | 258.0687 |
MDL Number: | MFCD00792456 |
SMILES: | BrCC(=O)c1ccc(c(c1)C(=O)N)O |
Complexity: | 244 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.5 |
European journal of medicinal chemistry 20041001