AI55784
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 90% (HPLC) | in stock | $31.00 | $22.00 | - + | |
1g | 90% (HPLC) | in stock | $76.00 | $53.00 | - + | |
5g | 90% (HPLC) | in stock | $140.00 | $98.00 | - + | |
10g | 90% (HPLC) | in stock | $238.00 | $167.00 | - + | |
25g | 90% (HPLC) | in stock | $594.00 | $416.00 | - + | |
100g | 95% | in stock | $2,112.00 | $1,479.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI55784 |
Chemical Name: | Guanosine-5'-diphosphate disodium salt |
CAS Number: | 7415-69-2 |
Molecular Formula: | C10H13N5Na2O11P2 |
Molecular Weight: | 487.1642 |
MDL Number: | MFCD00066538 |
SMILES: | [O-][C@@H]1[C@@H](COP(=O)(OP(=O)(O)O)O)O[C@H]([C@@H]1[O-])n1cnc2c1nc(N)[nH]c2=O.[Na+].[Na+] |
Guanosine-5-diphosphate disodium salt, also known as GDP-Na₂, is a crucial molecule in chemical synthesis. This high-quality reagent is primarily utilized in biochemistry and molecular biology for the production and manipulation of nucleic acids, proteins, and other biomolecules. It serves as a building block for the synthesis of RNA and DNA sequences in laboratory settings, facilitating the study of genetic information and protein interactions. Additionally, GDP-Na₂ is commonly employed in the development of pharmaceuticals, specifically in drug discovery research and the study of enzyme mechanisms. Its role in chemical synthesis extends to the creation of fluorescent probes, enzyme assays, and other analytical tools essential for biochemical studies. Overall, GDP-Na₂ is an indispensable tool for researchers and scientists working in the fields of biochemistry, molecular biology, and drug development.