AI55785
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $7.00 | $5.00 | - + | |
5g | 98% | in stock | $9.00 | $6.00 | - + | |
10g | 98% | in stock | $11.00 | $8.00 | - + | |
25g | 98% | in stock | $26.00 | $18.00 | - + | |
100g | 95% | in stock | $94.00 | $66.00 | - + | |
500g | 98% | in stock | $212.00 | $149.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI55785 |
Chemical Name: | L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid |
CAS Number: | 74163-81-8 |
Molecular Formula: | C10H11NO2 |
Molecular Weight: | 177.1998 |
MDL Number: | MFCD00144533 |
SMILES: | OC(=O)[C@H]1NCc2c(C1)cccc2 |
Complexity: | 205 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | -1.3 |
Nanomedicine : nanotechnology, biology, and medicine 20121001
European journal of medicinal chemistry 20091201
Bioorganic & medicinal chemistry 20081101