AB56740
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $12.00 | $9.00 | - + | |
5g | 97% | in stock | $24.00 | $17.00 | - + | |
10g | 97% | in stock | $44.00 | $31.00 | - + | |
25g | 97% | in stock | $85.00 | $60.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB56740 |
Chemical Name: | 1-(Mesitylsulfonyl)-3-nitro-1H-1,2,4-triazole |
CAS Number: | 74257-00-4 |
Molecular Formula: | C11H12N4O4S |
Molecular Weight: | 296.3024 |
MDL Number: | MFCD09751282 |
SMILES: | Cc1cc(C)cc(c1S(=O)(=O)n1cnc(n1)[N+](=O)[O-])C |
1-(Mesitylsulfonyl)-3-nitro-1H-1,2,4-triazole is a powerful reagent widely used in chemical synthesis for the preparation of various organic compounds. This versatile compound serves as a key building block in the synthesis of complex molecules, including pharmaceuticals, agrochemicals, and materials.In chemical synthesis, 1-(Mesitylsulfonyl)-3-nitro-1H-1,2,4-triazole plays a crucial role as a protecting group for amines and amino acids. By selectively masking these functional groups with the mesitylsulfonyl moiety, chemists can control the reactivity of the molecules and direct specific chemical transformations without affecting other parts of the molecule. This protection strategy enables the sequential and controlled synthesis of intricate organic structures with high precision and efficiency.Furthermore, 1-(Mesitylsulfonyl)-3-nitro-1H-1,2,4-triazole is commonly used as a nitroarylating agent in cross-coupling reactions to introduce the nitro group into various aromatic compounds. This nitro group serves as a versatile handle for further synthetic elaboration, allowing chemists to access a wide range of functionalized molecules with diverse properties and applications.Overall, the application of 1-(Mesitylsulfonyl)-3-nitro-1H-1,2,4-triazole in chemical synthesis provides chemists with a valuable tool for the construction of complex organic molecules with strategic control over functional group manipulation and diversification.