AB52400
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $15.00 | $10.00 | - + | |
250mg | 95% | in stock | $28.00 | $20.00 | - + | |
1g | 95% | in stock | $76.00 | $54.00 | - + | |
5g | 95% | in stock | $269.00 | $189.00 | - + | |
10g | 95% | in stock | $465.00 | $325.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52400 |
Chemical Name: | Methyl trans-3-amino-cyclobutanecarboxylate hydrochloride |
CAS Number: | 74316-29-3 |
Molecular Formula: | C6H12ClNO2 |
Molecular Weight: | 165.618 |
MDL Number: | MFCD17977174 |
SMILES: | COC(=O)[C@@H]1C[C@H](C1)N.Cl |
Methyl trans-3-aminocyclobutanecarboxylate hydrochloride is a versatile compound widely utilized in chemical synthesis due to its unique properties and reactivity. This compound serves as a valuable building block for the preparation of various pharmaceutical intermediates and complex organic molecules. By incorporating Methyl trans-3-aminocyclobutanecarboxylate hydrochloride into synthetic routes, chemists can efficiently introduce both the cyclobutane and amino functional groups into target molecules, enabling the synthesis of diverse organic compounds with enhanced biological activities. Furthermore, the presence of the ester and amine moieties in this compound offers opportunities for further functionalization through various chemical reactions, expanding its utility in the synthesis of specialized materials and compounds with tailored properties.