AC58192
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $23.00 | $17.00 | - + | |
1g | 95% | in stock | $29.00 | $21.00 | - + | |
5g | 98% | in stock | $85.00 | $60.00 | - + | |
100g | 98% | in stock | $1,319.00 | $923.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC58192 |
Chemical Name: | 4-Bromo-N-phenylbenzenesulfonamide |
CAS Number: | 7454-54-8 |
Molecular Formula: | C12H10BrNO2S |
Molecular Weight: | 312.1823 |
MDL Number: | MFCD01136685 |
SMILES: | Brc1ccc(cc1)S(=O)(=O)Nc1ccccc1 |
Complexity: | 325 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.9 |
Acta crystallographica. Section C, Crystal structure communications 20060801
Journal of medicinal chemistry 20041007