AB68495
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $73.00 | $51.00 | - + | |
1g | 95% | in stock | $121.00 | $85.00 | - + | |
5g | 95% | in stock | $380.00 | $266.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB68495 |
Chemical Name: | 5-(4-Hydroxybenzyl)-2,4-thiazolidinedione |
CAS Number: | 74772-78-4 |
Molecular Formula: | C10H9NO3S |
Molecular Weight: | 223.24835999999996 |
MDL Number: | MFCD00754499 |
SMILES: | O=C1NC(=O)SC1Cc1ccc(cc1)O |
Complexity: | 274 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 1.7 |
Journal of medicinal chemistry 20121011
Bioorganic & medicinal chemistry letters 20110915
Bioorganic & medicinal chemistry letters 20110815
Bioorganic & medicinal chemistry letters 20040517