AH50083
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% (stabilized with TBC) | in stock | $37.00 | $26.00 | - + | |
250mg | 95% (stabilized with TBC) | in stock | $45.00 | $32.00 | - + | |
1g | 96% | in stock | $63.00 | $44.00 | - + | |
5g | 96% | in stock | $82.00 | $58.00 | - + | |
25g | 96% | in stock | $106.00 | $75.00 | - + | |
100g | 96% | in stock | $275.00 | $193.00 | - + | |
500g | 96% | in stock | $931.00 | $652.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH50083 |
Chemical Name: | (S)-2,5-Dihydro-pyrrole-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester |
CAS Number: | 74844-93-2 |
Molecular Formula: | C11H17NO4 |
Molecular Weight: | 227.2570 |
MDL Number: | MFCD00080341 |
SMILES: | COC(=O)[C@@H]1C=CCN1C(=O)OC(C)(C)C |
(S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate, commonly referred to as $name$, is a versatile compound used in chemical synthesis for various applications. This compound is particularly valuable in asymmetric synthesis, where it serves as a key chiral building block for the preparation of enantiomerically pure compounds.One of the notable applications of (S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate is in the synthesis of pharmaceuticals and agrochemicals. Its unique chiral structure allows for the creation of molecules with specific stereochemistry, which is crucial for enhancing the biological activity and efficacy of these products. By incorporating this compound into synthetic routes, chemists can access a wide range of enantiomerically pure compounds that exhibit desired pharmacological properties.Furthermore, (S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate plays a significant role in the development of new materials and catalysts. Its chiral nature enables the synthesis of advanced materials with tailored properties, such as optoelectronic materials, liquid crystals, and polymers. Additionally, this compound can be utilized in the preparation of chiral ligands for asymmetric catalysis, facilitating the production of complex molecules with high selectivity and efficiency.In summary, (S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate is a valuable tool in chemical synthesis, offering opportunities for the creation of enantiomerically pure compounds with diverse applications in pharmaceuticals, agrochemicals, materials science, and catalysis.