AC52078
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $511.00 | $358.00 | - + | |
5g | 97% | in stock | $1,879.00 | $1,316.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC52078 |
Chemical Name: | (2S)-2-Amino-N-benzylpropanamide |
CAS Number: | 75040-72-1 |
Molecular Formula: | C10H14N2O |
Molecular Weight: | 178.231 |
MDL Number: | MFCD09724356 |
SMILES: | C[C@@H](C(=O)NCc1ccccc1)N |
Complexity: | 164 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.5 |
Journal of medicinal chemistry 20111013
Journal of medicinal chemistry 20110714
Bioorganic & medicinal chemistry letters 20091201