AB42820
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $17.00 | - + | |
5g | 95% | in stock | $33.00 | $23.00 | - + | |
25g | 95% | in stock | $45.00 | $31.00 | - + | |
100g | 95% | in stock | $156.00 | $109.00 | - + | |
500g | 95% | in stock | $673.00 | $471.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42820 |
Chemical Name: | (3R,4R)-4-Acetoxy-3-[(R)-(tert-butyldimethylsilyloxy)ethyl]-2-azetidinone |
CAS Number: | 76855-69-1 |
Molecular Formula: | C13H25NO4Si |
Molecular Weight: | 287.4274 |
MDL Number: | MFCD00077636 |
SMILES: | CC(=O)O[C@H]1NC(=O)[C@H]1[C@H](O[Si](C(C)(C)C)(C)C)C |
Complexity: | 375 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
Journal of medicinal chemistry 20091126