AB54010
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $6.00 | $4.00 | - + | |
25g | 98% | in stock | $12.00 | $9.00 | - + | |
100g | 98%(GC) | in stock | $30.00 | $21.00 | - + | |
500g | 98% | in stock | $57.00 | $40.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB54010 |
Chemical Name: | 2,3,4-Trifluoro-1-nitrobenzene |
CAS Number: | 771-69-7 |
Molecular Formula: | C6H2F3NO2 |
Molecular Weight: | 177.0808 |
MDL Number: | MFCD00041546 |
SMILES: | [O-][N+](=O)c1ccc(c(c1F)F)F |
Complexity: | 184 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
XLogP3: | 2.1 |
The Journal of organic chemistry 20100903