AB48171
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $20.00 | $14.00 | - + | |
5g | 96% | in stock | $66.00 | $47.00 | - + | |
25g | 96% | in stock | $286.00 | $201.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB48171 |
Chemical Name: | (S)-3-Amino-2-cbz-amino-propionic acid tert-butyl ester |
CAS Number: | 77215-55-5 |
Molecular Formula: | C15H22N2O4 |
Molecular Weight: | 294.3462 |
MDL Number: | MFCD09991588 |
SMILES: | NC[C@@H](C(=O)OC(C)(C)C)NC(=O)OCc1ccccc1 |
Complexity: | 346 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
XLogP3: | 1.4 |
(S)-tert-Butyl 3-amino-2-(((benzyloxy)carbonyl)amino)propanoate is a valuable compound widely used in chemical synthesis due to its versatile reactivity and utility in organic transformations. This chiral building block is crucial in the preparation of various complex molecules with pharmaceutical, agrochemical, and material science applications. Its asymmetric nature allows for precise stereochemistry control in the synthesis of biologically active compounds, making it a key reagent in the production of pharmaceutical intermediates and natural product derivatives. Additionally, (S)-tert-Butyl 3-amino-2-(((benzyloxy)carbonyl)amino)propanoate serves as a critical intermediate in the construction of peptide mimics, peptidomimetics, and other bioactive molecules, enabling researchers to explore novel chemical space and develop innovative medicinal agents with enhanced properties. Its unique structural features and reactivity make it a valuable tool for synthetic chemists seeking to access diverse chemical structures and advance the field of organic synthesis.