AC70957
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $28.00 | $19.00 | - + | |
1g | 95% | in stock | $128.00 | $90.00 | - + | |
5g | 95% | in stock | $473.00 | $331.00 | - + | |
10g | 95% | in stock | $775.00 | $543.00 | - + | |
25g | 95% | in stock | $1,536.00 | $1,075.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC70957 |
Chemical Name: | Benzyl 3-hydroxybenzoate |
CAS Number: | 77513-40-7 |
Molecular Formula: | C14H12O3 |
Molecular Weight: | 228.2433 |
MDL Number: | MFCD11225903 |
SMILES: | Oc1cccc(c1)C(=O)OCc1ccccc1 |
Complexity: | 246 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.6 |
Journal of natural products 20030501