78-73-9 | 2-Hydroxy-N,N,N-trimethylethanaminium hydrogencarbonate

Packsize	Purity	Availability	Price	Discounted Price
1g	80%	in stock	$60.00	$42.00
5g	80%	in stock	$137.00	$96.00
25g	80%	in stock	$361.00	$253.00
100g	80%	in stock	$1,083.00	$759.00

Description

• Catalog Number: AB50687
• Chemical Name: 2-Hydroxy-N,N,N-trimethylethanaminium hydrogencarbonate
• CAS Number: 78-73-9
• Molecular Formula: C6H15NO4
• Molecular Weight: 165.1876
• MDL Number: MFCD00031689
• SMILES: [O-]C(=O)O.OCC[N+](C)(C)C

Upstream Synthesis Route

Choline bicarbonate, also known as 2-hydroxyethyl(trimethyl)azanium bicarbonate, is a versatile chemical compound widely used in various chemical synthesis processes. In the field of organic chemistry, choline bicarbonate serves as a key reagent in the synthesis of various compounds due to its unique properties and reactivity.One of the primary applications of choline bicarbonate in chemical synthesis is as a source of choline in the production of pharmaceuticals and nutraceuticals. Choline, an essential nutrient for humans, plays a crucial role in various physiological functions such as neurotransmission, lipid metabolism, and cell membrane integrity. By using choline bicarbonate as a precursor, chemists can efficiently incorporate choline into organic molecules, enabling the synthesis of choline-enriched compounds with specific biological activities.Additionally, choline bicarbonate can serve as a mild base in organic synthesis reactions. Its basic nature allows it to participate in various transformations, such as deprotonation reactions, condensation reactions, and nucleophilic substitutions. In this way, choline bicarbonate can facilitate the formation of new carbon-carbon and carbon-heteroatom bonds, expanding the synthetic possibilities in organic chemistry.Furthermore, choline bicarbonate can act as a stabilizing agent in certain chemical reactions by maintaining the pH balance and preventing undesired side reactions. Its ability to buffer solutions effectively makes it a valuable additive in reactions where pH control is critical for the desired outcome.Overall, choline bicarbonate is a versatile compound that finds widespread applications in chemical synthesis, particularly in the production of pharmaceuticals, nutraceuticals, and various organic molecules. Its unique properties as a choline source, mild base, and pH stabilizer make it an indispensable reagent in the arsenal of synthetic chemists.