AH49099
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 99% | in stock | $101.00 | $71.00 | - + | |
250mg | 99% | in stock | $161.00 | $113.00 | - + | |
1g | 99% | in stock | $377.00 | $264.00 | - + | |
5g | 99% | in stock | $1,540.00 | $1,078.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH49099 |
Chemical Name: | Cycloastragenol |
CAS Number: | 78574-94-4 |
Molecular Formula: | C30H50O5 |
Molecular Weight: | 490.715 |
MDL Number: | MFCD24849201 |
SMILES: | O[C@H]1C[C@@]2([C@]([C@H]1[C@@]1(C)CC[C@H](O1)C(O)(C)C)(C)CC[C@@]13[C@H]2C[C@H](O)[C@@H]2[C@]3(C1)CC[C@@H](C2(C)C)O)C |
Complexity: | 916 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 12 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.4 |
Drug metabolism and pharmacokinetics 20100101