AH50640
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | ≥95% | in stock | $74.00 | $52.00 | - + | |
10mg | ≥95% | in stock | $110.00 | $77.00 | - + | |
25mg | ≥95% | in stock | $249.00 | $174.00 | - + | |
50mg | ≥95% | in stock | $425.00 | $297.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH50640 |
Chemical Name: | garcinol |
CAS Number: | 78824-30-3 |
Molecular Formula: | C38H50O6 |
Molecular Weight: | 602.8000 |
MDL Number: | MFCD03700761 |
SMILES: | CC(=CCC12C(=O)C(=C(c3ccc(c(c3)O)O)O)C(=O)C(C1=O)(CC(C(=C)C)CC=C(C)C)CC(C2(C)C)CC=C(C)C)C |
Garcinol, also known as benzophenone, is a versatile compound widely used in chemical synthesis processes. Its unique structure and properties make it a valuable tool in the production of various organic compounds.One of the key applications of Garcinol in chemical synthesis is as a reagent in the formation of carbon-carbon bonds. It serves as a powerful nucleophile in reactions such as the Friedel-Crafts acylation and the Wittig reaction, facilitating the creation of complex organic molecules.Garcinol can also be utilized as a precursor in the synthesis of pharmaceuticals and natural products. Its ability to undergo various functional group transformations allows chemists to access a diverse range of molecular structures, making it an indispensable building block in organic chemistry.Furthermore, Garcinol exhibits antioxidant properties, making it an attractive candidate for the development of new materials and polymers with enhanced stability and durability. Its role as a radical scavenger can help improve the performance and longevity of various products in industries ranging from pharmaceuticals to cosmetics.Overall, Garcinol plays a crucial role in modern chemical synthesis, offering researchers a valuable tool for the creation of novel compounds and materials with broad applications in industry and academia.