AI56508
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $9.00 | $6.00 | - + | |
5mg | 95% | in stock | $25.00 | $18.00 | - + | |
10mg | 95% | in stock | $27.00 | $19.00 | - + | |
50mg | 95% | in stock | $72.00 | $51.00 | - + | |
100mg | 95% | in stock | $124.00 | $87.00 | - + | |
250mg | 95% | in stock | $208.00 | $146.00 | - + | |
1g | 95% | in stock | $561.00 | $393.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI56508 |
Chemical Name: | Nicaraven |
CAS Number: | 79455-30-4 |
Molecular Formula: | C15H16N4O2 |
Molecular Weight: | 284.3131 |
MDL Number: | MFCD00411904 |
SMILES: | CC(NC(=O)c1cccnc1)CNC(=O)c1cccnc1 |
Complexity: | 362 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 0.5 |
BMC neuroscience 20090101
Anticancer research 20060101
Rinsho shinkeigaku = Clinical neurology 20031101
Canadian journal of physiology and pharmacology 20030701
Rinsho shinkeigaku = Clinical neurology 20011201