AE01456
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | for spectrophotometric det. of Fe, Emax 593nm Fe2+/Ferene>34000 | in stock | $22.00 | $16.00 | - + | |
1g | for spectrophotometric det. of Fe, Emax 593nm Fe2+/Ferene>34000 | in stock | $36.00 | $25.00 | - + | |
5g | for spectrophotometric det. of Fe, Emax 593nm Fe2+/Ferene>34000 | in stock | $136.00 | $95.00 | - + | |
25g | for spectrophotometric det. of Fe, Emax 593nm Fe2+/Ferene>34000 | in stock | $521.00 | $365.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE01456 |
Chemical Name: | Ferene disodium salt |
CAS Number: | 79551-14-7 |
Molecular Formula: | C16H8N4Na2O8S2 |
Molecular Weight: | 494.3663 |
MDL Number: | MFCD00150606 |
SMILES: | [O-]S(=O)(=O)c1ccc(o1)c1nc(nnc1c1ccc(o1)S(=O)(=O)[O-])c1ccccn1.[Na+].[Na+] |
Sodium 5,5'-(3-(pyridin-2-yl)-1,2,4-triazine-5,6-diyl)bis(furan-2-sulfonate) is a versatile compound widely used in chemical synthesis. It serves as a key reagent in the preparation of various organic compounds due to its unique structural properties and reactivity. In chemical synthesis, this compound acts as a valuable building block for the creation of complex molecular structures, particularly in the field of medicinal chemistry and material science.One of the primary applications of Sodium 5,5'-(3-(pyridin-2-yl)-1,2,4-triazine-5,6-diyl)bis(furan-2-sulfonate) is in the synthesis of heterocyclic compounds. Its triazine and pyridine moieties, combined with the furan sulfonate groups, enable the formation of intricate ring systems with diverse functionalities. These heterocycles are crucial in the development of pharmaceuticals, agrochemicals, and advanced materials.Furthermore, this compound plays a significant role in the construction of molecular scaffolds for drug discovery. By incorporating Sodium 5,5'-(3-(pyridin-2-yl)-1,2,4-triazine-5,6-diyl)bis(furan-2-sulfonate) into synthetic pathways, chemists can access novel chemical entities with potential biological activities. Its ability to modify the properties of organic molecules makes it an invaluable tool in the design and optimization of new drugs and therapies.Overall, Sodium 5,5'-(3-(pyridin-2-yl)-1,2,4-triazine-5,6-diyl)bis(furan-2-sulfonate) is an indispensable reagent in the realm of chemical synthesis, enabling researchers to explore diverse synthetic strategies and create molecular architectures with tailored functionalities and applications.