AE01409
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $7.00 | $5.00 | - + | |
250mg | 97% | in stock | $13.00 | $9.00 | - + | |
1g | 97% | in stock | $20.00 | $14.00 | - + | |
5g | 97% | in stock | $62.00 | $44.00 | - + | |
10g | 97% | in stock | $102.00 | $71.00 | - + | |
25g | 97% | in stock | $253.00 | $177.00 | - + | |
100g | 97% | in stock | $1,009.00 | $706.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE01409 |
Chemical Name: | (S)-1-N-Boc-piperazine-2-carboxylic acid methyl ester |
CAS Number: | 796096-64-5 |
Molecular Formula: | C11H20N2O4 |
Molecular Weight: | 244.2875 |
MDL Number: | MFCD04115328 |
SMILES: | COC(=O)[C@@H]1CNCCN1C(=O)OC(C)(C)C |
Complexity: | 298 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.4 |
The (S)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate is a valuable compound widely used in chemical synthesis. This versatile molecule serves as a key building block in the creation of various organic compounds due to its unique structural properties. In chemical synthesis, (S)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate can be employed as a chiral ligand in asymmetric catalysis reactions, where it aids in the formation of enantiomerically pure products. Additionally, this compound can act as a precursor in the synthesis of pharmaceutical intermediates and agrochemicals, contributing to the development of novel and potent compounds. Its strategic incorporation in synthetic routes enables the selective formation of desired stereochemistry, making it an essential tool for chemists engaged in the creation of complex organic molecules.