AB47812
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $17.00 | $12.00 | - + | |
1g | 97% | in stock | $21.00 | $15.00 | - + | |
5g | 97% | in stock | $98.00 | $69.00 | - + | |
10g | 97% | in stock | $163.00 | $114.00 | - + | |
25g | 97% | in stock | $341.00 | $239.00 | - + | |
100g | 97% | in stock | $1,008.00 | $706.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB47812 |
Chemical Name: | H-Allo-Thr-OMe HCl |
CAS Number: | 79617-27-9 |
Molecular Formula: | C5H12ClNO3 |
Molecular Weight: | 169.6067 |
MDL Number: | MFCD00237766 |
SMILES: | COC(=O)[C@H]([C@@H](O)C)N.Cl |
Complexity: | 104 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
L-allo-Threonine Methyl Ester Hydrochloride is a valuable chemical compound widely utilized in chemical synthesis processes. With its unique properties and structure, this compound plays a crucial role in the creation of various organic molecules and pharmaceutical intermediates. Specifically, L-allo-Threonine Methyl Ester Hydrochloride is often employed as a key building block in the synthesis of complex amino acids and peptides. Its controlled and selective reactivity allows for precise manipulation of molecular structures, making it an essential component in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Additionally, this compound serves as a versatile chiral precursor, enabling the synthesis of enantiomerically pure compounds used in a range of industries. In the realm of chemical synthesis, L-allo-Threonine Methyl Ester Hydrochloride stands as a fundamental tool for creating diverse and sophisticated molecules with high efficiency and precision.