AC34553
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $6.00 | $4.00 | - + | |
10mg | 97% | in stock | $7.00 | $5.00 | - + | |
100mg | 97% | in stock | $9.00 | $6.00 | - + | |
250mg | 97% | in stock | $13.00 | $9.00 | - + | |
1g | 97% | in stock | $35.00 | $25.00 | - + | |
5g | 97% | in stock | $170.00 | $119.00 | - + | |
25g | 97% | in stock | $596.00 | $417.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC34553 |
Chemical Name: | Disuccinimidyl glutarate |
CAS Number: | 79642-50-5 |
Molecular Formula: | C13H14N2O8 |
Molecular Weight: | 326.2589 |
MDL Number: | MFCD00153597 |
SMILES: | O=C(ON1C(=O)CCC1=O)CCCC(=O)ON1C(=O)CCC1=O |
Complexity: | 503 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 8 |
Rotatable Bond Count: | 8 |
XLogP3: | -1.5 |
Disuccinimidyl glutarate, also known as DSG, is a versatile chemical reagent commonly used in chemical synthesis processes. It functions as a crosslinking agent that forms stable amide bonds between primary amines, making it a valuable tool in the field of bioconjugation and protein chemistry. In chemical synthesis, DSG plays a crucial role in linking biomolecules such as peptides, proteins, and antibodies to solid surfaces or other molecules. This enables the creation of conjugates that retain the biological activity of the individual components while facilitating their study or manipulation in various research applications. Furthermore, DSG's ability to selectively react with primary amines in physiological conditions makes it a preferred choice for creating stable conjugates in biological systems. Its high water solubility and mild reaction conditions ensure minimal interference with the structure and function of biomolecules, making it a versatile tool in the realms of drug delivery, diagnostics, and biomaterials.
Biochemistry 20070703
Analytical and bioanalytical chemistry 20070601
Molecular immunology 20070201
Bioconjugate chemistry 20050101
Biochemistry 20040210
Glycoconjugate journal 20040101
Artificial cells, blood substitutes, and immobilization biotechnology 20010701
Journal of computational biology : a journal of computational molecular cell biology 20010101