AB56164
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $6.00 | $4.00 | - + | |
5g | 95% | in stock | $11.00 | $8.00 | - + | |
10g | 95% | in stock | $19.00 | $14.00 | - + | |
25g | 95% | in stock | $23.00 | $17.00 | - + | |
100g | 95% | in stock | $91.00 | $64.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB56164 |
Chemical Name: | (S)-(-)-Indoline-2-carboxylic acid |
CAS Number: | 79815-20-6 |
Molecular Formula: | C9H9NO2 |
Molecular Weight: | 163.1733 |
MDL Number: | MFCD00070578 |
SMILES: | OC(=O)[C@@H]1Cc2c(N1)cccc2 |
Complexity: | 193 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.6 |
(2S)-2-Indolinecarboxylic acid plays a crucial role in chemical synthesis due to its versatile applications. As a chiral building block, it is widely utilized in the pharmaceutical industry to synthesize various biologically active compounds. Its enantiopure form is especially valuable in the creation of pharmaceutical drugs, where chirality plays a significant role in determining the drug's efficacy and safety.In addition, (2S)-2-Indolinecarboxylic acid is often employed as a catalyst or intermediate in organic reactions, contributing to the formation of complex molecules with specific stereochemistry. Its presence in the synthesis of natural products, amino acids, and other complex organic compounds underscores its importance in modern organic chemistry.Overall, (2S)-2-Indolinecarboxylic acid serves as a foundational component in chemical synthesis, enabling the development of novel molecules with diverse applications in pharmaceuticals, materials science, and other industries.
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501