AH49527
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 99% | 1 week | $216.00 | $151.00 | - + | |
10mg | 99% | 1 week | $276.00 | $193.00 | - + | |
25mg | 99% | 1 week | $410.00 | $287.00 | - + | |
50mg | 99% | 1 week | $560.00 | $392.00 | - + | |
100mg | 99% | 1 week | $756.00 | $529.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH49527 |
Chemical Name: | Aloin (Mixture of A and B) |
CAS Number: | 8015-61-0 |
Molecular Formula: | C5H9F2NO |
Molecular Weight: | 137.1279 |
MDL Number: | MFCD00869345 |
SMILES: | FC([C@@H]1NC[C@@H](C1)O)F |