AB52352
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | in stock | $15.00 | $10.00 | - + | ||
5g | in stock | $16.00 | $11.00 | - + | ||
25g | in stock | $28.00 | $19.00 | - + | ||
100g | in stock | $65.00 | $45.00 | - + | ||
250g | in stock | $132.00 | $93.00 | - + | ||
1kg | in stock | $377.00 | $264.00 | - + | ||
5kg | in stock | $1,424.00 | $997.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52352 |
Chemical Name: | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) |
CAS Number: | 81-88-9 |
Molecular Formula: | C28H31ClN2O3 |
Molecular Weight: | 479.0103 |
MDL Number: | MFCD00011931 |
SMILES: | CCN(c1ccc2c(c1)[o+]c1c(c2c2ccccc2C(=O)O)ccc(c1)N(CC)CC)CC.[Cl-] |
Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) is a versatile chemical compound that finds its primary application in chemical synthesis processes. This compound serves as a crucial reagent in organic chemistry due to its ability to undergo various chemical reactions. In chemical synthesis, Xanthylium chloride can act as a catalyst, mediator, or precursor for the formation of complex organic molecules. Its unique structure and reactive properties make it particularly valuable in the development of pharmaceuticals, dyes, and other fine chemicals. By participating in key organic transformations, Xanthylium chloride enables the efficient and selective synthesis of target compounds, making it an indispensable tool for chemists and researchers in the field.