logo
Home  > Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1)

AB52352

81-88-9 | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1)

Packsize Purity Availability Price Discounted Price    Quantity
1g 97% in stock $8.00 $6.00 -   +
5g 97% in stock $10.00 $7.00 -   +
25g 97% in stock $17.00 $12.00 -   +
100g 97% in stock $35.00 $25.00 -   +
5kg 97 in stock $1,424.00 $997.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB52352
Chemical Name: Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1)
CAS Number: 81-88-9
Molecular Formula: C28H31ClN2O3
Molecular Weight: 479.0103
MDL Number: MFCD00011931
SMILES: CCN(c1ccc2c(c1)[o+]c1c(c2c2ccccc2C(=O)O)ccc(c1)N(CC)CC)CC.[Cl-]

 

Upstream Synthesis Route 
  • Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1) is a versatile chemical compound that finds its primary application in chemical synthesis processes. This compound serves as a crucial reagent in organic chemistry due to its ability to undergo various chemical reactions. In chemical synthesis, Xanthylium chloride can act as a catalyst, mediator, or precursor for the formation of complex organic molecules. Its unique structure and reactive properties make it particularly valuable in the development of pharmaceuticals, dyes, and other fine chemicals. By participating in key organic transformations, Xanthylium chloride enables the efficient and selective synthesis of target compounds, making it an indispensable tool for chemists and researchers in the field.
FEATURED PRODUCTS