AI56682
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $63.00 | $44.00 | - + | |
5g | 95% | in stock | $159.00 | $111.00 | - + | |
25g | 95% | in stock | $405.00 | $283.00 | - + | |
100g | 95% | in stock | $1,335.00 | $934.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI56682 |
Chemical Name: | 5'-O-(4,4'-Dimethoxytrityl)-N2-isobutyryl-2'-guanosine |
CAS Number: | 81246-83-5 |
Molecular Formula: | C35H37N5O8 |
Molecular Weight: | 655.697 |
MDL Number: | MFCD00797504 |
SMILES: | COc1ccc(cc1)C(C([C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(NC(=O)C(C)C)[nH]c2=O)O)(c1ccc(cc1)OC)c1ccccc1 |
Complexity: | 1130 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 48 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 5 |
Rotatable Bond Count: | 10 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 4.4 |
The 5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-N-(2-methyl-1-oxopropyl)guanosine is a valuable compound in chemical synthesis due to its versatile applications. It serves as an important building block in the creation of nucleic acid analogs, which are utilized in various research fields such as drug development and molecular biology. Additionally, this compound plays a crucial role in the development of modified nucleosides for potential therapeutic purposes. Its unique structure and functional groups make it a promising candidate for designing novel molecules with specific biological activities.