AI56706
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $299.00 | $209.00 | - + | |
5g | 98% | in stock | $1,024.00 | $717.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI56706 |
Chemical Name: | 1-Benzoyl-3-(5-chloro-2-hydroxyphenyl)thiourea |
CAS Number: | 815612-78-3 |
Molecular Formula: | C14H11ClN2O2S |
Molecular Weight: | 306.76733999999993 |
MDL Number: | MFCD05877780 |
SMILES: | S=C(Nc1cc(Cl)ccc1O)NC(=O)c1ccccc1 |
Complexity: | 361 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.8 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20121201