AB42744
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $9.00 | $7.00 | - + | |
5g | 98% | in stock | $18.00 | $13.00 | - + | |
10g | 98% | in stock | $31.00 | $22.00 | - + | |
25g | 98% | in stock | $76.00 | $54.00 | - + | |
100g | 98% | in stock | $248.00 | $174.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42744 |
Chemical Name: | D-Homophenylalanine |
CAS Number: | 82795-51-5 |
Molecular Formula: | C10H13NO2 |
Molecular Weight: | 179.2157 |
MDL Number: | MFCD00063091 |
SMILES: | N[C@@H](C(=O)O)CCc1ccccc1 |
Complexity: | 164 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | -1.2 |
Theranostics 20120101
PLoS neglected tropical diseases 20100901
Bioorganic & medicinal chemistry 20100415
Journal of the American Chemical Society 20090902
European journal of medicinal chemistry 20090901
Journal of natural products 20090801
Bioscience, biotechnology, and biochemistry 20090601
BMC evolutionary biology 20080101
PloS one 20080101
ChemMedChem 20070701
Bioorganic & medicinal chemistry 20070515
Journal of natural products 20070501
Amino acids 20070201
ChemMedChem 20060801
Bioorganic & medicinal chemistry letters 20060715
The Biochemical journal 20051215
Combinatorial chemistry & high throughput screening 20050601
Bioorganic & medicinal chemistry letters 20041018
The Journal of biological chemistry 20031219
Electrophoresis 20021201
Peptides 20010901