AH56770
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $195.00 | $136.00 | - + | |
250mg | 95% | in stock | $346.00 | $242.00 | - + | |
1g | 95% | in stock | $603.00 | $422.00 | - + | |
5g | 95% | in stock | $2,345.00 | $1,642.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH56770 |
Chemical Name: | (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-benzylpropanoic acid |
CAS Number: | 828254-16-6 |
Molecular Formula: | C25H23NO4 |
Molecular Weight: | 401.4544 |
MDL Number: | MFCD07372498 |
SMILES: | O=C(OCC1c2ccccc2-c2c1cccc2)NC[C@H](C(=O)O)Cc1ccccc1 |
Complexity: | 566 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
XLogP3: | 4.5 |
(αR)-α-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]benzenepropanoic acid is a versatile compound widely utilized in chemical synthesis for its unique properties and applications. In organic chemistry, this compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials.In the field of medicinal chemistry, (αR)-α-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]benzenepropanoic acid plays a crucial role in the synthesis of new drug candidates and bioactive molecules. Its structural features make it an ideal precursor for the modification of active pharmaceutical ingredients, leading to the development of novel drugs with enhanced therapeutic effects and improved pharmacokinetic properties.Furthermore, in the realm of agrochemicals, this compound is instrumental in the design and synthesis of pesticides, herbicides, and fungicides. Its chemical structure allows for the introduction of specific functional groups that impart desired biological activities, making it a valuable tool for creating environmentally friendly and effective crop protection products.Moreover, (αR)-α-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]benzenepropanoic acid finds applications in material science, where it is employed in the fabrication of polymers, coatings, and specialty chemicals. Its versatility and reactivity enable the incorporation of this compound into advanced materials with tailored properties, such as adhesion, durability, and thermal stability.Overall, the significance of (αR)-α-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]benzenepropanoic acid in chemical synthesis cannot be overstated, as it serves as a fundamental building block for creating innovative compounds across various industries, driving advancements in science and technology.