AC27909
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $19.00 | $13.00 | - + | |
10g | 95% | in stock | $19.00 | $13.00 | - + | |
25g | 95% | in stock | $22.00 | $15.00 | - + | |
100g | 95% | in stock | $63.00 | $45.00 | - + | |
500g | 95% | in stock | $249.00 | $175.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC27909 |
Chemical Name: | Diethyl phenylmalonate |
CAS Number: | 83-13-6 |
Molecular Formula: | C13H16O4 |
Molecular Weight: | 236.26374 |
MDL Number: | MFCD00009144 |
SMILES: | CCOC(=O)C(c1ccccc1)C(=O)OCC |
Complexity: | 238 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 7 |
XLogP3: | 2.6 |
Chemical research in toxicology 20121015
Enzyme research 20120101
The Journal of organic chemistry 20111118
Enzyme research 20100101
Applied biochemistry and biotechnology 20090501