AH51442
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $34.00 | $24.00 | - + | |
1g | 95% | in stock | $77.00 | $54.00 | - + | |
5g | 95% | in stock | $283.00 | $198.00 | - + | |
10g | 95% | in stock | $503.00 | $352.00 | - + | |
25g | 95% | in stock | $1,007.00 | $705.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH51442 |
Chemical Name: | N-Benzylbenzenesulfonamide |
CAS Number: | 837-18-3 |
Molecular Formula: | C13H13NO2S |
Molecular Weight: | 247.3128 |
MDL Number: | MFCD00092709 |
SMILES: | O=S(=O)(c1ccccc1)NCc1ccccc1 |
NSC Number: | 25016 |
Complexity: | 309 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.4 |
Journal of medicinal chemistry 20120112
Acta crystallographica. Section E, Structure reports online 20091001