AB52370
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $11.00 | $8.00 | - + | |
10g | 98% | in stock | $48.00 | $34.00 | - + | |
25g | 98% | in stock | $86.00 | $61.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52370 |
Chemical Name: | (2S)-1-[(tert-butoxy)carbonyl]-4-methylidenepyrrolidine-2-carboxylic acid |
CAS Number: | 84348-38-9 |
Molecular Formula: | C11H17NO4 |
Molecular Weight: | 227.257 |
MDL Number: | MFCD01861787 |
SMILES: | O=C(N1CC(=C)C[C@H]1C(=O)O)OC(C)(C)C |
Complexity: | 329 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1 |
N-tert-Butoxycarbonyl-4-methylene-L-proline is a valuable reagent in chemical synthesis due to its unique structural features and versatile reactivity. This compound serves as a pivotal building block in the preparation of various organic molecules, particularly in the field of peptide and pharmaceutical synthesis. By virtue of its N-protecting group and α, β-unsaturated nature, N-tert-Butoxycarbonyl-4-methylene-L-proline can participate in a wide range of transformations, such as Michael additions, cyclizations, and cross-coupling reactions. Its strategic placement within a molecule allows for selective functionalization and manipulation of peptide sequences, enabling the synthesis of complex and biologically active compounds. Furthermore, the presence of the tert-butoxycarbonyl group offers protection to the amino functionality, facilitating sequential synthesis steps and enhancing overall synthetic efficiency. With its utility in peptide chemistry and drug discovery, N-tert-Butoxycarbonyl-4-methylene-L-proline is an indispensable tool for organic chemists seeking to access diverse structures and novel chemical entities.