AD93820
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $33.00 | $23.00 | - + | |
5mg | ≥98% | in stock | $65.00 | $45.00 | - + | |
50mg | 98+% | in stock | $83.00 | $58.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD93820 |
Chemical Name: | BIIB021 |
CAS Number: | 848695-25-0 |
Molecular Formula: | C14H15ClN6O |
Molecular Weight: | 318.7615 |
MDL Number: | MFCD15528939 |
SMILES: | COc1c(C)cnc(c1C)Cn1cnc2c1nc(N)nc2Cl |
Complexity: | 388 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.9 |
Immunopharmacology and immunotoxicology 20160101
Bioorganic & medicinal chemistry letters 20140101
Bioorganic & medicinal chemistry letters 20130801
Journal of medicinal chemistry 20120913
Drug metabolism and disposition: the biological fate of chemicals 20120401
Journal of medicinal chemistry 20101028
International journal of cancer 20100301
International journal of cancer 20100301
Biomarkers : biochemical indicators of exposure, response, and susceptibility to chemicals 20100201
Journal of medicinal chemistry 20100114
Clinical cancer research : an official journal of the American Association for Cancer Research 20090815
Molecular cancer therapeutics 20090401
Bioorganic & medicinal chemistry 20090315
Journal of medicinal chemistry 20070614