AC20780
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $19.00 | $13.00 | - + | |
25g | 95% | in stock | $20.00 | $14.00 | - + | |
100g | 95% | in stock | $31.00 | $22.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC20780 |
Chemical Name: | 2-(4-Hydroxybenzoyl)benzoic acid |
CAS Number: | 85-57-4 |
Molecular Formula: | C14H10O4 |
Molecular Weight: | 242.2268 |
MDL Number: | MFCD00016507 |
SMILES: | Oc1ccc(cc1)C(=O)c1ccccc1C(=O)O |
Complexity: | 318 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.1 |
Journal of medicinal chemistry 20040506