logo
Home  > Hydroxy-peg-5-t-butyl ester

AH55222

850090-09-4 | Hydroxy-peg-5-t-butyl ester

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $22.00 $15.00 -   +
250mg 95% in stock $28.00 $19.00 -   +
5g 95% in stock $225.00 $158.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AH55222
Chemical Name: Hydroxy-peg-5-t-butyl ester
CAS Number: 850090-09-4
Molecular Formula: C17H34O8
Molecular Weight: 366.44705999999985
MDL Number: MFCD20926402
SMILES: OCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The compound 4,7,10,13,16-Pentaoxaoctadecanoic acid, 18-hydroxy-, 1,1-dimethylethyl ester is commonly used in chemical synthesis as a versatile building block for creating various functionalized molecules. Its unique structure containing both an ester group and multiple oxygen atoms along the alkyl chain allows for its incorporation into complex organic structures. This compound is often employed in the synthesis of specialty polymers, surfactants, and pharmaceutical intermediates due to its ability to introduce oxygen functionality in a controlled manner. Its use in chemistry enables the creation of tailored molecular structures with specific properties and applications in diverse fields such as materials science and medicinal chemistry.
FEATURED PRODUCTS