AC26645
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $74.00 | $52.00 | - + | |
5g | 98% | in stock | $251.00 | $176.00 | - + | |
25g | 98% | in stock | $760.00 | $532.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC26645 |
Chemical Name: | 2-Nitro-4-trifluoromethylphenyl disulfide |
CAS Number: | 860-39-9 |
Molecular Formula: | C14H6F6N2O4S2 |
Molecular Weight: | 444.3289 |
MDL Number: | MFCD00018043 |
SMILES: | [O-][N+](=O)c1cc(ccc1SSc1ccc(cc1[N+](=O)[O-])C(F)(F)F)C(F)(F)F |
Complexity: | 530 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 12 |
Rotatable Bond Count: | 3 |
XLogP3: | 5.1 |
Journal of medicinal chemistry 19960913