AB52160
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 95% | in stock | $42.00 | $29.00 | - + | |
10mg | 95% | in stock | $62.00 | $44.00 | - + | |
25mg | 95% | in stock | $101.00 | $71.00 | - + | |
50mg | 95% | in stock | $141.00 | $99.00 | - + | |
100mg | 95% | in stock | $248.00 | $173.00 | - + | |
250mg | 95% | in stock | $486.00 | $340.00 | - + | |
1g | 95% | in stock | $1,217.00 | $852.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52160 |
Chemical Name: | (αS)-α-[[2-(4-Morpholinyl)acetyl]amino]benzenebutanoyl-L-leucyl-N-[(1S)-3-methyl-1-[[(2R)-2-methyl-2-oxiranyl]carbonyl]butyl]-L-phenylalaninamide |
CAS Number: | 868540-17-4 |
Molecular Formula: | C40H57N5O7 |
Molecular Weight: | 719.9099 |
MDL Number: | MFCD11040997 |
SMILES: | CC(C[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)[C@@]1(C)CO1)CC(C)C)Cc1ccccc1)NC(=O)[C@@H](NC(=O)CN1CCOCC1)CCc1ccccc1)C |
The (αS)-α-[[2-(4-Morpholinyl)acetyl]amino]benzenebutanoyl-L-leucyl-N-[(1S)-3-methyl-1-[[(2R)-2-methyl-2-oxiranyl]carbonyl]butyl]-L-phenylalaninamide compound is primarily utilized in chemical synthesis as a versatile building block due to its unique structural features and functional groups. Its strategic placement within a synthetic pathway allows for the precise manipulation and introduction of specific moieties or structural elements, contributing to the controlled design and construction of complex molecules. This compound's tailored reactivity and compatibility with various chemical reactions make it an invaluable tool for the synthesis of diverse molecular scaffolds, enabling the creation of novel compounds with potential applications in medicinal chemistry, materials science, and other fields requiring custom-designed molecules.