AC10219
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $23.00 | $16.00 | - + | |
1g | 95% | in stock | $30.00 | $21.00 | - + | |
10g | 95% | in stock | $281.00 | $197.00 | - + | |
25g | 95% | in stock | $603.00 | $422.00 | - + | |
100g | 95% | in stock | $2,002.00 | $1,402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC10219 |
Chemical Name: | 1H-Indole-3-carboxylic acid,6-bromo-,methyl ester |
CAS Number: | 868656-97-7 |
Molecular Formula: | C10H8BrNO2 |
Molecular Weight: | 254.08001999999996 |
MDL Number: | MFCD09836005 |
SMILES: | COC(=O)c1c[nH]c2c1ccc(c2)Br |
Complexity: | 234 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.3 |
Journal of natural products 20051001